C22H21N3O7S2 — CID 175695375
methyl 4-[[2-(benzylsulfonylcarbamoylamino)phenyl]sulfonylamino]benzoate (PubChem CID 175695375) has the molecular formula C22H21N3O7S2 and a molecular weight of 503.56 g/mol. Its IUPAC name is methyl 4-[[2-(benzylsulfonylcarbamoylamino)phenyl]sulfonylamino]benzoate.
| Compound Name | methyl 4-[[2-(benzylsulfonylcarbamoylamino)phenyl]sulfonylamino]benzoate |
|---|---|
| PubChem CID | 175695375 |
| Molecular Formula | C22H21N3O7S2 |
| Molecular Weight | 503.56 g/mol |
| Exact Mass | 503.08 |
| IUPAC Name | methyl 4-[[2-(benzylsulfonylcarbamoylamino)phenyl]sulfonylamino]benzoate |
| SMILES | COC(=O)c1ccc(NS(=O)(=O)c2ccccc2NC(=O)NS(=O)(=O)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C22H21N3O7S2/c1-32-21(26)17-11-13-18(14-12-17)24-34(30,31)20-10-6-5-9-19(20)23-22(27)25-33(28,29)15-16-7-3-2-4-8-16/h2-14,24H,15H2,1H3,(H2,23,25,27) |
| InChIKey | WBMNSFBKDUCGID-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 147.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.56 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |