C20H18ClN3O5S2 — CID 138617489
1-[2-[(2-chlorophenyl)sulfamoyl]phenyl]-3-(4-methylphenyl)sulfonylurea (PubChem CID 138617489) has the molecular formula C20H18ClN3O5S2 and a molecular weight of 479.97 g/mol. Its IUPAC name is 1-[2-[(2-chlorophenyl)sulfamoyl]phenyl]-3-(4-methylphenyl)sulfonylurea.
| Compound Name | 1-[2-[(2-chlorophenyl)sulfamoyl]phenyl]-3-(4-methylphenyl)sulfonylurea |
|---|---|
| PubChem CID | 138617489 |
| Molecular Formula | C20H18ClN3O5S2 |
| Molecular Weight | 479.97 g/mol |
| Exact Mass | 479.04 |
| IUPAC Name | 1-[2-[(2-chlorophenyl)sulfamoyl]phenyl]-3-(4-methylphenyl)sulfonylurea |
| SMILES | Cc1ccc(S(=O)(=O)NC(=O)Nc2ccccc2S(=O)(=O)Nc2ccccc2Cl)cc1 |
| InChI | InChI=1S/C20H18ClN3O5S2/c1-14-10-12-15(13-11-14)30(26,27)24-20(25)22-18-8-4-5-9-19(18)31(28,29)23-17-7-3-2-6-16(17)21/h2-13,23H,1H3,(H2,22,24,25) |
| InChIKey | JPSJOYIHAIFOEX-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 121.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.97 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |