C23H19ClN2O4S — CID 57391244
1-[2-[(E)-3-(2-chlorophenyl)prop-2-enoyl]phenyl]-3-(4-methylphenyl)sulfonylurea (PubChem CID 57391244) has the molecular formula C23H19ClN2O4S and a molecular weight of 454.94 g/mol. Its IUPAC name is 1-[2-[(E)-3-(2-chlorophenyl)prop-2-enoyl]phenyl]-3-(4-methylphenyl)sulfonylurea.
| Compound Name | 1-[2-[(E)-3-(2-chlorophenyl)prop-2-enoyl]phenyl]-3-(4-methylphenyl)sulfonylurea |
|---|---|
| PubChem CID | 57391244 |
| Molecular Formula | C23H19ClN2O4S |
| Molecular Weight | 454.94 g/mol |
| Exact Mass | 454.08 |
| IUPAC Name | 1-[2-[(E)-3-(2-chlorophenyl)prop-2-enoyl]phenyl]-3-(4-methylphenyl)sulfonylurea |
| SMILES | Cc1ccc(S(=O)(=O)NC(=O)Nc2ccccc2C(=O)/C=C/c2ccccc2Cl)cc1 |
| InChI | InChI=1S/C23H19ClN2O4S/c1-16-10-13-18(14-11-16)31(29,30)26-23(28)25-21-9-5-3-7-19(21)22(27)15-12-17-6-2-4-8-20(17)24/h2-15H,1H3,(H2,25,26,28)/b15-12+ |
| InChIKey | FDQBKKMMPNBCOY-NTCAYCPXSA-N |
| XLogP | 5.05 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.94 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|