C15H14FNO5S — CID 23647766
6-[(4-fluorophenyl)sulfonylamino]-3-(hydroxymethyl)-2-methylbenzoic acid (PubChem CID 23647766) has the molecular formula C15H14FNO5S and a molecular weight of 339.34 g/mol. Its IUPAC name is 6-[(4-fluorophenyl)sulfonylamino]-3-(hydroxymethyl)-2-methylbenzoic acid.
| Compound Name | 6-[(4-fluorophenyl)sulfonylamino]-3-(hydroxymethyl)-2-methylbenzoic acid |
|---|---|
| PubChem CID | 23647766 |
| Molecular Formula | C15H14FNO5S |
| Molecular Weight | 339.34 g/mol |
| Exact Mass | 339.06 |
| IUPAC Name | 6-[(4-fluorophenyl)sulfonylamino]-3-(hydroxymethyl)-2-methylbenzoic acid |
| SMILES | Cc1c(CO)ccc(NS(=O)(=O)c2ccc(F)cc2)c1C(=O)O |
| InChI | InChI=1S/C15H14FNO5S/c1-9-10(8-18)2-7-13(14(9)15(19)20)17-23(21,22)12-5-3-11(16)4-6-12/h2-7,17-18H,8H2,1H3,(H,19,20) |
| InChIKey | QQJCQNCWGQUXSD-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.34 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |