C17H12ClNO4S — CID 10044144
2-[(4-chlorophenyl)sulfonylamino]naphthalene-1-carboxylic acid (PubChem CID 10044144) has the molecular formula C17H12ClNO4S and a molecular weight of 361.81 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)sulfonylamino]naphthalene-1-carboxylic acid.
| Compound Name | 2-[(4-chlorophenyl)sulfonylamino]naphthalene-1-carboxylic acid |
|---|---|
| PubChem CID | 10044144 |
| Molecular Formula | C17H12ClNO4S |
| Molecular Weight | 361.81 g/mol |
| Exact Mass | 361.02 |
| IUPAC Name | 2-[(4-chlorophenyl)sulfonylamino]naphthalene-1-carboxylic acid |
| SMILES | O=C(O)c1c(NS(=O)(=O)c2ccc(Cl)cc2)ccc2ccccc12 |
| InChI | InChI=1S/C17H12ClNO4S/c18-12-6-8-13(9-7-12)24(22,23)19-15-10-5-11-3-1-2-4-14(11)16(15)17(20)21/h1-10,19H,(H,20,21) |
| InChIKey | XDLPOXNXGRRODJ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.81 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |