C22H15Cl2NO2S — CID 156767618
N-(2,4-dichlorophenyl)-4-naphthalen-2-ylbenzenesulfonamide (PubChem CID 156767618) has the molecular formula C22H15Cl2NO2S and a molecular weight of 428.34 g/mol. Its IUPAC name is N-(2,4-dichlorophenyl)-4-naphthalen-2-ylbenzenesulfonamide.
| Compound Name | N-(2,4-dichlorophenyl)-4-naphthalen-2-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 156767618 |
| Molecular Formula | C22H15Cl2NO2S |
| Molecular Weight | 428.34 g/mol |
| Exact Mass | 427.02 |
| IUPAC Name | N-(2,4-dichlorophenyl)-4-naphthalen-2-ylbenzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc(Cl)cc1Cl)c1ccc(-c2ccc3ccccc3c2)cc1 |
| InChI | InChI=1S/C22H15Cl2NO2S/c23-19-9-12-22(21(24)14-19)25-28(26,27)20-10-7-16(8-11-20)18-6-5-15-3-1-2-4-17(15)13-18/h1-14,25H |
| InChIKey | MVRZZELRUJZHAI-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.34 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |