C26H22Cl2N2O4S — CID 94864467
(2R)-N-[4-[(2,4-dichlorophenyl)sulfamoyl]phenyl]-2-naphthalen-2-yloxybutanamide (PubChem CID 94864467) has the molecular formula C26H22Cl2N2O4S and a molecular weight of 529.45 g/mol. Its IUPAC name is (2R)-N-[4-[(2,4-dichlorophenyl)sulfamoyl]phenyl]-2-naphthalen-2-yloxybutanamide.
| Compound Name | (2R)-N-[4-[(2,4-dichlorophenyl)sulfamoyl]phenyl]-2-naphthalen-2-yloxybutanamide |
|---|---|
| PubChem CID | 94864467 |
| Molecular Formula | C26H22Cl2N2O4S |
| Molecular Weight | 529.45 g/mol |
| Exact Mass | 528.07 |
| IUPAC Name | (2R)-N-[4-[(2,4-dichlorophenyl)sulfamoyl]phenyl]-2-naphthalen-2-yloxybutanamide |
| SMILES | CC[C@@H](Oc1ccc2ccccc2c1)C(=O)Nc1ccc(S(=O)(=O)Nc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C26H22Cl2N2O4S/c1-2-25(34-21-11-7-17-5-3-4-6-18(17)15-21)26(31)29-20-9-12-22(13-10-20)35(32,33)30-24-14-8-19(27)16-23(24)28/h3-16,25,30H,2H2,1H3,(H,29,31)/t25-/m1/s1 |
| InChIKey | FKRHMGXTSVVXQO-RUZDIDTESA-N |
| XLogP | 6.74 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.45 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |