C23H22Cl2N2O4S — CID 93488130
(2R)-N-[4-[(2,4-dichlorophenyl)sulfamoyl]phenyl]-2-(2-methylphenoxy)butanamide (PubChem CID 93488130) has the molecular formula C23H22Cl2N2O4S and a molecular weight of 493.41 g/mol. Its IUPAC name is (2R)-N-[4-[(2,4-dichlorophenyl)sulfamoyl]phenyl]-2-(2-methylphenoxy)butanamide.
| Compound Name | (2R)-N-[4-[(2,4-dichlorophenyl)sulfamoyl]phenyl]-2-(2-methylphenoxy)butanamide |
|---|---|
| PubChem CID | 93488130 |
| Molecular Formula | C23H22Cl2N2O4S |
| Molecular Weight | 493.41 g/mol |
| Exact Mass | 492.07 |
| IUPAC Name | (2R)-N-[4-[(2,4-dichlorophenyl)sulfamoyl]phenyl]-2-(2-methylphenoxy)butanamide |
| SMILES | CC[C@@H](Oc1ccccc1C)C(=O)Nc1ccc(S(=O)(=O)Nc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C23H22Cl2N2O4S/c1-3-21(31-22-7-5-4-6-15(22)2)23(28)26-17-9-11-18(12-10-17)32(29,30)27-20-13-8-16(24)14-19(20)25/h4-14,21,27H,3H2,1-2H3,(H,26,28)/t21-/m1/s1 |
| InChIKey | RXKAJEZPJWJKIL-OAQYLSRUSA-N |
| XLogP | 5.90 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.41 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |