C24H25ClN2O4S — CID 43908669
2-(3-chlorophenoxy)-N-[4-[(2,6-dimethylphenyl)sulfamoyl]phenyl]butanamide (PubChem CID 43908669) has the molecular formula C24H25ClN2O4S and a molecular weight of 472.99 g/mol. Its IUPAC name is 2-(3-chlorophenoxy)-N-[4-[(2,6-dimethylphenyl)sulfamoyl]phenyl]butanamide.
| Compound Name | 2-(3-chlorophenoxy)-N-[4-[(2,6-dimethylphenyl)sulfamoyl]phenyl]butanamide |
|---|---|
| PubChem CID | 43908669 |
| Molecular Formula | C24H25ClN2O4S |
| Molecular Weight | 472.99 g/mol |
| Exact Mass | 472.12 |
| IUPAC Name | 2-(3-chlorophenoxy)-N-[4-[(2,6-dimethylphenyl)sulfamoyl]phenyl]butanamide |
| SMILES | CCC(Oc1cccc(Cl)c1)C(=O)Nc1ccc(S(=O)(=O)Nc2c(C)cccc2C)cc1 |
| InChI | InChI=1S/C24H25ClN2O4S/c1-4-22(31-20-10-6-9-18(25)15-20)24(28)26-19-11-13-21(14-12-19)32(29,30)27-23-16(2)7-5-8-17(23)3/h5-15,22,27H,4H2,1-3H3,(H,26,28) |
| InChIKey | UMBKRXVGCAUSLU-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.99 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |