C20H19ClN4O4S — CID 38005936
(2R)-2-(3-chlorophenoxy)-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]butanamide (PubChem CID 38005936) has the molecular formula C20H19ClN4O4S and a molecular weight of 446.92 g/mol. Its IUPAC name is (2R)-2-(3-chlorophenoxy)-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]butanamide.
| Compound Name | (2R)-2-(3-chlorophenoxy)-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]butanamide |
|---|---|
| PubChem CID | 38005936 |
| Molecular Formula | C20H19ClN4O4S |
| Molecular Weight | 446.92 g/mol |
| Exact Mass | 446.08 |
| IUPAC Name | (2R)-2-(3-chlorophenoxy)-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]butanamide |
| SMILES | CC[C@@H](Oc1cccc(Cl)c1)C(=O)Nc1ccc(S(=O)(=O)Nc2ncccn2)cc1 |
| InChI | InChI=1S/C20H19ClN4O4S/c1-2-18(29-16-6-3-5-14(21)13-16)19(26)24-15-7-9-17(10-8-15)30(27,28)25-20-22-11-4-12-23-20/h3-13,18H,2H2,1H3,(H,24,26)(H,22,23,25)/t18-/m1/s1 |
| InChIKey | ATGFKCAISRRXHR-GOSISDBHSA-N |
| XLogP | 3.73 |
| TPSA | 110.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.92 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |