C26H23ClN2O4S — CID 46770765
N-[4-[(4-chlorophenyl)sulfamoyl]phenyl]-2-naphthalen-2-yloxybutanamide (PubChem CID 46770765) has the molecular formula C26H23ClN2O4S and a molecular weight of 495.00 g/mol. Its IUPAC name is N-[4-[(4-chlorophenyl)sulfamoyl]phenyl]-2-naphthalen-2-yloxybutanamide.
| Compound Name | N-[4-[(4-chlorophenyl)sulfamoyl]phenyl]-2-naphthalen-2-yloxybutanamide |
|---|---|
| PubChem CID | 46770765 |
| Molecular Formula | C26H23ClN2O4S |
| Molecular Weight | 495.00 g/mol |
| Exact Mass | 494.11 |
| IUPAC Name | N-[4-[(4-chlorophenyl)sulfamoyl]phenyl]-2-naphthalen-2-yloxybutanamide |
| SMILES | CCC(Oc1ccc2ccccc2c1)C(=O)Nc1ccc(S(=O)(=O)Nc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C26H23ClN2O4S/c1-2-25(33-23-14-7-18-5-3-4-6-19(18)17-23)26(30)28-21-12-15-24(16-13-21)34(31,32)29-22-10-8-20(27)9-11-22/h3-17,25,29H,2H2,1H3,(H,28,30) |
| InChIKey | HLGWHVJAWZWKIY-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.00 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |