C28H28N2O5S — CID 17106989
N-[4-[(4-ethoxyphenyl)sulfamoyl]phenyl]-2-naphthalen-2-yloxybutanamide (PubChem CID 17106989) has the molecular formula C28H28N2O5S and a molecular weight of 504.61 g/mol. Its IUPAC name is N-[4-[(4-ethoxyphenyl)sulfamoyl]phenyl]-2-naphthalen-2-yloxybutanamide.
| Compound Name | N-[4-[(4-ethoxyphenyl)sulfamoyl]phenyl]-2-naphthalen-2-yloxybutanamide |
|---|---|
| PubChem CID | 17106989 |
| Molecular Formula | C28H28N2O5S |
| Molecular Weight | 504.61 g/mol |
| Exact Mass | 504.17 |
| IUPAC Name | N-[4-[(4-ethoxyphenyl)sulfamoyl]phenyl]-2-naphthalen-2-yloxybutanamide |
| SMILES | CCOc1ccc(NS(=O)(=O)c2ccc(NC(=O)C(CC)Oc3ccc4ccccc4c3)cc2)cc1 |
| InChI | InChI=1S/C28H28N2O5S/c1-3-27(35-25-14-9-20-7-5-6-8-21(20)19-25)28(31)29-22-12-17-26(18-13-22)36(32,33)30-23-10-15-24(16-11-23)34-4-2/h5-19,27,30H,3-4H2,1-2H3,(H,29,31) |
| InChIKey | XMPSVYOAKJIHIF-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.61 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |