C26H30N2O5S — CID 92677320
(2S)-2-(2,5-dimethylphenoxy)-N-[4-[(4-ethoxyphenyl)sulfamoyl]phenyl]butanamide (PubChem CID 92677320) has the molecular formula C26H30N2O5S and a molecular weight of 482.60 g/mol. Its IUPAC name is (2S)-2-(2,5-dimethylphenoxy)-N-[4-[(4-ethoxyphenyl)sulfamoyl]phenyl]butanamide.
| Compound Name | (2S)-2-(2,5-dimethylphenoxy)-N-[4-[(4-ethoxyphenyl)sulfamoyl]phenyl]butanamide |
|---|---|
| PubChem CID | 92677320 |
| Molecular Formula | C26H30N2O5S |
| Molecular Weight | 482.60 g/mol |
| Exact Mass | 482.19 |
| IUPAC Name | (2S)-2-(2,5-dimethylphenoxy)-N-[4-[(4-ethoxyphenyl)sulfamoyl]phenyl]butanamide |
| SMILES | CCOc1ccc(NS(=O)(=O)c2ccc(NC(=O)[C@H](CC)Oc3cc(C)ccc3C)cc2)cc1 |
| InChI | InChI=1S/C26H30N2O5S/c1-5-24(33-25-17-18(3)7-8-19(25)4)26(29)27-20-11-15-23(16-12-20)34(30,31)28-21-9-13-22(14-10-21)32-6-2/h7-17,24,28H,5-6H2,1-4H3,(H,27,29)/t24-/m0/s1 |
| InChIKey | NRYJUXLVEBNUJN-DEOSSOPVSA-N |
| XLogP | 5.30 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.60 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |