C25H28N2O6S — CID 26076761
(2S)-N-[4-[(4-ethoxyphenyl)sulfamoyl]phenyl]-2-(4-methoxyphenoxy)butanamide (PubChem CID 26076761) has the molecular formula C25H28N2O6S and a molecular weight of 484.57 g/mol. Its IUPAC name is (2S)-N-[4-[(4-ethoxyphenyl)sulfamoyl]phenyl]-2-(4-methoxyphenoxy)butanamide.
| Compound Name | (2S)-N-[4-[(4-ethoxyphenyl)sulfamoyl]phenyl]-2-(4-methoxyphenoxy)butanamide |
|---|---|
| PubChem CID | 26076761 |
| Molecular Formula | C25H28N2O6S |
| Molecular Weight | 484.57 g/mol |
| Exact Mass | 484.17 |
| IUPAC Name | (2S)-N-[4-[(4-ethoxyphenyl)sulfamoyl]phenyl]-2-(4-methoxyphenoxy)butanamide |
| SMILES | CCOc1ccc(NS(=O)(=O)c2ccc(NC(=O)[C@H](CC)Oc3ccc(OC)cc3)cc2)cc1 |
| InChI | InChI=1S/C25H28N2O6S/c1-4-24(33-22-14-12-20(31-3)13-15-22)25(28)26-18-8-16-23(17-9-18)34(29,30)27-19-6-10-21(11-7-19)32-5-2/h6-17,24,27H,4-5H2,1-3H3,(H,26,28)/t24-/m0/s1 |
| InChIKey | GOAYMHHOUARIDB-DEOSSOPVSA-N |
| XLogP | 4.69 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.57 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |