C28H28N2O4S — CID 99949850
(2S)-2-(2,5-dimethylphenoxy)-N-[4-(naphthalen-1-ylsulfamoyl)phenyl]butanamide (PubChem CID 99949850) has the molecular formula C28H28N2O4S and a molecular weight of 488.61 g/mol. Its IUPAC name is (2S)-2-(2,5-dimethylphenoxy)-N-[4-(naphthalen-1-ylsulfamoyl)phenyl]butanamide.
| Compound Name | (2S)-2-(2,5-dimethylphenoxy)-N-[4-(naphthalen-1-ylsulfamoyl)phenyl]butanamide |
|---|---|
| PubChem CID | 99949850 |
| Molecular Formula | C28H28N2O4S |
| Molecular Weight | 488.61 g/mol |
| Exact Mass | 488.18 |
| IUPAC Name | (2S)-2-(2,5-dimethylphenoxy)-N-[4-(naphthalen-1-ylsulfamoyl)phenyl]butanamide |
| SMILES | CC[C@H](Oc1cc(C)ccc1C)C(=O)Nc1ccc(S(=O)(=O)Nc2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C28H28N2O4S/c1-4-26(34-27-18-19(2)12-13-20(27)3)28(31)29-22-14-16-23(17-15-22)35(32,33)30-25-11-7-9-21-8-5-6-10-24(21)25/h5-18,26,30H,4H2,1-3H3,(H,29,31)/t26-/m0/s1 |
| InChIKey | CYZTZNCMBMLORF-SANMLTNESA-N |
| XLogP | 6.05 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.61 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |