C28H28N2O4S — CID 92679459
(2R)-N-[4-[(2,4-dimethylphenyl)sulfamoyl]phenyl]-2-naphthalen-1-yloxybutanamide (PubChem CID 92679459) has the molecular formula C28H28N2O4S and a molecular weight of 488.61 g/mol. Its IUPAC name is (2R)-N-[4-[(2,4-dimethylphenyl)sulfamoyl]phenyl]-2-naphthalen-1-yloxybutanamide.
| Compound Name | (2R)-N-[4-[(2,4-dimethylphenyl)sulfamoyl]phenyl]-2-naphthalen-1-yloxybutanamide |
|---|---|
| PubChem CID | 92679459 |
| Molecular Formula | C28H28N2O4S |
| Molecular Weight | 488.61 g/mol |
| Exact Mass | 488.18 |
| IUPAC Name | (2R)-N-[4-[(2,4-dimethylphenyl)sulfamoyl]phenyl]-2-naphthalen-1-yloxybutanamide |
| SMILES | CC[C@@H](Oc1cccc2ccccc12)C(=O)Nc1ccc(S(=O)(=O)Nc2ccc(C)cc2C)cc1 |
| InChI | InChI=1S/C28H28N2O4S/c1-4-26(34-27-11-7-9-21-8-5-6-10-24(21)27)28(31)29-22-13-15-23(16-14-22)35(32,33)30-25-17-12-19(2)18-20(25)3/h5-18,26,30H,4H2,1-3H3,(H,29,31)/t26-/m1/s1 |
| InChIKey | VAVQSQXRTHDNLC-AREMUKBSSA-N |
| XLogP | 6.05 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.61 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |