C27H26N2O4S — CID 28636606
(2S)-N-[4-[(2-methylphenyl)sulfamoyl]phenyl]-2-naphthalen-2-yloxybutanamide (PubChem CID 28636606) has the molecular formula C27H26N2O4S and a molecular weight of 474.58 g/mol. Its IUPAC name is (2S)-N-[4-[(2-methylphenyl)sulfamoyl]phenyl]-2-naphthalen-2-yloxybutanamide.
| Compound Name | (2S)-N-[4-[(2-methylphenyl)sulfamoyl]phenyl]-2-naphthalen-2-yloxybutanamide |
|---|---|
| PubChem CID | 28636606 |
| Molecular Formula | C27H26N2O4S |
| Molecular Weight | 474.58 g/mol |
| Exact Mass | 474.16 |
| IUPAC Name | (2S)-N-[4-[(2-methylphenyl)sulfamoyl]phenyl]-2-naphthalen-2-yloxybutanamide |
| SMILES | CC[C@H](Oc1ccc2ccccc2c1)C(=O)Nc1ccc(S(=O)(=O)Nc2ccccc2C)cc1 |
| InChI | InChI=1S/C27H26N2O4S/c1-3-26(33-23-15-12-20-9-5-6-10-21(20)18-23)27(30)28-22-13-16-24(17-14-22)34(31,32)29-25-11-7-4-8-19(25)2/h4-18,26,29H,3H2,1-2H3,(H,28,30)/t26-/m0/s1 |
| InChIKey | VKKOTDJBSAEAHL-SANMLTNESA-N |
| XLogP | 5.75 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.58 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |