C24H24Cl2N2O4S — CID 43907240
N-[4-[(2,3-dichlorophenyl)sulfamoyl]phenyl]-2-(3,4-dimethylphenoxy)butanamide (PubChem CID 43907240) has the molecular formula C24H24Cl2N2O4S and a molecular weight of 507.44 g/mol. Its IUPAC name is N-[4-[(2,3-dichlorophenyl)sulfamoyl]phenyl]-2-(3,4-dimethylphenoxy)butanamide.
| Compound Name | N-[4-[(2,3-dichlorophenyl)sulfamoyl]phenyl]-2-(3,4-dimethylphenoxy)butanamide |
|---|---|
| PubChem CID | 43907240 |
| Molecular Formula | C24H24Cl2N2O4S |
| Molecular Weight | 507.44 g/mol |
| Exact Mass | 506.08 |
| IUPAC Name | N-[4-[(2,3-dichlorophenyl)sulfamoyl]phenyl]-2-(3,4-dimethylphenoxy)butanamide |
| SMILES | CCC(Oc1ccc(C)c(C)c1)C(=O)Nc1ccc(S(=O)(=O)Nc2cccc(Cl)c2Cl)cc1 |
| InChI | InChI=1S/C24H24Cl2N2O4S/c1-4-22(32-18-11-8-15(2)16(3)14-18)24(29)27-17-9-12-19(13-10-17)33(30,31)28-21-7-5-6-20(25)23(21)26/h5-14,22,28H,4H2,1-3H3,(H,27,29) |
| InChIKey | CDYGOOBZWPPYMF-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.44 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |