C23H22Cl2N2O5S — CID 43907526
N-[4-[(2,3-dichlorophenyl)sulfamoyl]phenyl]-2-(3-methoxyphenoxy)butanamide (PubChem CID 43907526) has the molecular formula C23H22Cl2N2O5S and a molecular weight of 509.41 g/mol. Its IUPAC name is N-[4-[(2,3-dichlorophenyl)sulfamoyl]phenyl]-2-(3-methoxyphenoxy)butanamide.
| Compound Name | N-[4-[(2,3-dichlorophenyl)sulfamoyl]phenyl]-2-(3-methoxyphenoxy)butanamide |
|---|---|
| PubChem CID | 43907526 |
| Molecular Formula | C23H22Cl2N2O5S |
| Molecular Weight | 509.41 g/mol |
| Exact Mass | 508.06 |
| IUPAC Name | N-[4-[(2,3-dichlorophenyl)sulfamoyl]phenyl]-2-(3-methoxyphenoxy)butanamide |
| SMILES | CCC(Oc1cccc(OC)c1)C(=O)Nc1ccc(S(=O)(=O)Nc2cccc(Cl)c2Cl)cc1 |
| InChI | InChI=1S/C23H22Cl2N2O5S/c1-3-21(32-17-7-4-6-16(14-17)31-2)23(28)26-15-10-12-18(13-11-15)33(29,30)27-20-9-5-8-19(24)22(20)25/h4-14,21,27H,3H2,1-2H3,(H,26,28) |
| InChIKey | QKOIERSJQNZOSK-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.41 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |