C24H25FN2O4S — CID 92671713
(2S)-N-[4-[(2,4-dimethylphenyl)sulfamoyl]phenyl]-2-(4-fluorophenoxy)butanamide (PubChem CID 92671713) has the molecular formula C24H25FN2O4S and a molecular weight of 456.54 g/mol. Its IUPAC name is (2S)-N-[4-[(2,4-dimethylphenyl)sulfamoyl]phenyl]-2-(4-fluorophenoxy)butanamide.
| Compound Name | (2S)-N-[4-[(2,4-dimethylphenyl)sulfamoyl]phenyl]-2-(4-fluorophenoxy)butanamide |
|---|---|
| PubChem CID | 92671713 |
| Molecular Formula | C24H25FN2O4S |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.15 |
| IUPAC Name | (2S)-N-[4-[(2,4-dimethylphenyl)sulfamoyl]phenyl]-2-(4-fluorophenoxy)butanamide |
| SMILES | CC[C@H](Oc1ccc(F)cc1)C(=O)Nc1ccc(S(=O)(=O)Nc2ccc(C)cc2C)cc1 |
| InChI | InChI=1S/C24H25FN2O4S/c1-4-23(31-20-10-6-18(25)7-11-20)24(28)26-19-8-12-21(13-9-19)32(29,30)27-22-14-5-16(2)15-17(22)3/h5-15,23,27H,4H2,1-3H3,(H,26,28)/t23-/m0/s1 |
| InChIKey | MBECAYMRMUVFBD-QHCPKHFHSA-N |
| XLogP | 5.04 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |