C26H24N2O4S — CID 92681695
(2R)-2-naphthalen-1-yloxy-N-[4-(phenylsulfamoyl)phenyl]butanamide (PubChem CID 92681695) has the molecular formula C26H24N2O4S and a molecular weight of 460.56 g/mol. Its IUPAC name is (2R)-2-naphthalen-1-yloxy-N-[4-(phenylsulfamoyl)phenyl]butanamide.
| Compound Name | (2R)-2-naphthalen-1-yloxy-N-[4-(phenylsulfamoyl)phenyl]butanamide |
|---|---|
| PubChem CID | 92681695 |
| Molecular Formula | C26H24N2O4S |
| Molecular Weight | 460.56 g/mol |
| Exact Mass | 460.15 |
| IUPAC Name | (2R)-2-naphthalen-1-yloxy-N-[4-(phenylsulfamoyl)phenyl]butanamide |
| SMILES | CC[C@@H](Oc1cccc2ccccc12)C(=O)Nc1ccc(S(=O)(=O)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C26H24N2O4S/c1-2-24(32-25-14-8-10-19-9-6-7-13-23(19)25)26(29)27-20-15-17-22(18-16-20)33(30,31)28-21-11-4-3-5-12-21/h3-18,24,28H,2H2,1H3,(H,27,29)/t24-/m1/s1 |
| InChIKey | UPGZDAISSJPHJJ-XMMPIXPASA-N |
| XLogP | 5.44 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.56 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |