C20H18INO2 — CID 30396463
(2S)-N-(4-iodophenyl)-2-naphthalen-1-yloxybutanamide (PubChem CID 30396463) has the molecular formula C20H18INO2 and a molecular weight of 431.27 g/mol. Its IUPAC name is (2S)-N-(4-iodophenyl)-2-naphthalen-1-yloxybutanamide.
| Compound Name | (2S)-N-(4-iodophenyl)-2-naphthalen-1-yloxybutanamide |
|---|---|
| PubChem CID | 30396463 |
| Molecular Formula | C20H18INO2 |
| Molecular Weight | 431.27 g/mol |
| Exact Mass | 431.04 |
| IUPAC Name | (2S)-N-(4-iodophenyl)-2-naphthalen-1-yloxybutanamide |
| SMILES | CC[C@H](Oc1cccc2ccccc12)C(=O)Nc1ccc(I)cc1 |
| InChI | InChI=1S/C20H18INO2/c1-2-18(20(23)22-16-12-10-15(21)11-13-16)24-19-9-5-7-14-6-3-4-8-17(14)19/h3-13,18H,2H2,1H3,(H,22,23)/t18-/m0/s1 |
| InChIKey | FESHMKOUVRWILH-SFHVURJKSA-N |
| XLogP | 5.24 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.27 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|