C22H20ClNO4 — CID 43915723
methyl 2-chloro-5-(2-naphthalen-1-yloxybutanoylamino)benzoate (PubChem CID 43915723) has the molecular formula C22H20ClNO4 and a molecular weight of 397.86 g/mol. Its IUPAC name is methyl 2-chloro-5-(2-naphthalen-1-yloxybutanoylamino)benzoate.
| Compound Name | methyl 2-chloro-5-(2-naphthalen-1-yloxybutanoylamino)benzoate |
|---|---|
| PubChem CID | 43915723 |
| Molecular Formula | C22H20ClNO4 |
| Molecular Weight | 397.86 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | methyl 2-chloro-5-(2-naphthalen-1-yloxybutanoylamino)benzoate |
| SMILES | CCC(Oc1cccc2ccccc12)C(=O)Nc1ccc(Cl)c(C(=O)OC)c1 |
| InChI | InChI=1S/C22H20ClNO4/c1-3-19(28-20-10-6-8-14-7-4-5-9-16(14)20)21(25)24-15-11-12-18(23)17(13-15)22(26)27-2/h4-13,19H,3H2,1-2H3,(H,24,25) |
| InChIKey | FOVNBVUHOCXXNH-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.86 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |