C22H23NO4 — CID 92680294
(2R)-N-(3,4-dimethoxyphenyl)-2-naphthalen-1-yloxybutanamide (PubChem CID 92680294) has the molecular formula C22H23NO4 and a molecular weight of 365.43 g/mol. Its IUPAC name is (2R)-N-(3,4-dimethoxyphenyl)-2-naphthalen-1-yloxybutanamide.
| Compound Name | (2R)-N-(3,4-dimethoxyphenyl)-2-naphthalen-1-yloxybutanamide |
|---|---|
| PubChem CID | 92680294 |
| Molecular Formula | C22H23NO4 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | (2R)-N-(3,4-dimethoxyphenyl)-2-naphthalen-1-yloxybutanamide |
| SMILES | CC[C@@H](Oc1cccc2ccccc12)C(=O)Nc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C22H23NO4/c1-4-18(27-19-11-7-9-15-8-5-6-10-17(15)19)22(24)23-16-12-13-20(25-2)21(14-16)26-3/h5-14,18H,4H2,1-3H3,(H,23,24)/t18-/m1/s1 |
| InChIKey | HWIWKFYLCLYSIS-GOSISDBHSA-N |
| XLogP | 4.65 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |