C16H10F3NO2S — CID 9464601
N-(2,3,4-trifluorophenyl)naphthalene-2-sulfonamide (PubChem CID 9464601) has the molecular formula C16H10F3NO2S and a molecular weight of 337.32 g/mol. Its IUPAC name is N-(2,3,4-trifluorophenyl)naphthalene-2-sulfonamide.
| Compound Name | N-(2,3,4-trifluorophenyl)naphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 9464601 |
| Molecular Formula | C16H10F3NO2S |
| Molecular Weight | 337.32 g/mol |
| Exact Mass | 337.04 |
| IUPAC Name | N-(2,3,4-trifluorophenyl)naphthalene-2-sulfonamide |
| SMILES | O=S(=O)(Nc1ccc(F)c(F)c1F)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C16H10F3NO2S/c17-13-7-8-14(16(19)15(13)18)20-23(21,22)12-6-5-10-3-1-2-4-11(10)9-12/h1-9,20H |
| InChIKey | BQKHXYFJZXGUAX-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.32 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|