C18H18F3NO2S — CID 7939033
4-cyclohexyl-N-(2,3,4-trifluorophenyl)benzenesulfonamide (PubChem CID 7939033) has the molecular formula C18H18F3NO2S and a molecular weight of 369.41 g/mol. Its IUPAC name is 4-cyclohexyl-N-(2,3,4-trifluorophenyl)benzenesulfonamide.
| Compound Name | 4-cyclohexyl-N-(2,3,4-trifluorophenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 7939033 |
| Molecular Formula | C18H18F3NO2S |
| Molecular Weight | 369.41 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | 4-cyclohexyl-N-(2,3,4-trifluorophenyl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc(F)c(F)c1F)c1ccc(C2CCCCC2)cc1 |
| InChI | InChI=1S/C18H18F3NO2S/c19-15-10-11-16(18(21)17(15)20)22-25(23,24)14-8-6-13(7-9-14)12-4-2-1-3-5-12/h6-12,22H,1-5H2 |
| InChIKey | CXYSYKIUEKNSBX-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.41 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|