C14H18N4O2S — CID 35539697
4-cyclohexyl-N-(1H-1,2,4-triazol-5-yl)benzenesulfonamide (PubChem CID 35539697) has the molecular formula C14H18N4O2S and a molecular weight of 306.39 g/mol. Its IUPAC name is 4-cyclohexyl-N-(1H-1,2,4-triazol-5-yl)benzenesulfonamide.
| Compound Name | 4-cyclohexyl-N-(1H-1,2,4-triazol-5-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 35539697 |
| Molecular Formula | C14H18N4O2S |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 4-cyclohexyl-N-(1H-1,2,4-triazol-5-yl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ncn[nH]1)c1ccc(C2CCCCC2)cc1 |
| InChI | InChI=1S/C14H18N4O2S/c19-21(20,18-14-15-10-16-17-14)13-8-6-12(7-9-13)11-4-2-1-3-5-11/h6-11H,1-5H2,(H2,15,16,17,18) |
| InChIKey | ZEKVRQSJQOUDCP-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |