C23H23Cl2N3O2S — CID 19735410
N-[6-chloro-5-[(2-chlorophenyl)methyl]pyrimidin-4-yl]-4-cyclohexylbenzenesulfonamide (PubChem CID 19735410) has the molecular formula C23H23Cl2N3O2S and a molecular weight of 476.43 g/mol. Its IUPAC name is N-[6-chloro-5-[(2-chlorophenyl)methyl]pyrimidin-4-yl]-4-cyclohexylbenzenesulfonamide.
| Compound Name | N-[6-chloro-5-[(2-chlorophenyl)methyl]pyrimidin-4-yl]-4-cyclohexylbenzenesulfonamide |
|---|---|
| PubChem CID | 19735410 |
| Molecular Formula | C23H23Cl2N3O2S |
| Molecular Weight | 476.43 g/mol |
| Exact Mass | 475.09 |
| IUPAC Name | N-[6-chloro-5-[(2-chlorophenyl)methyl]pyrimidin-4-yl]-4-cyclohexylbenzenesulfonamide |
| SMILES | O=S(=O)(Nc1ncnc(Cl)c1Cc1ccccc1Cl)c1ccc(C2CCCCC2)cc1 |
| InChI | InChI=1S/C23H23Cl2N3O2S/c24-21-9-5-4-8-18(21)14-20-22(25)26-15-27-23(20)28-31(29,30)19-12-10-17(11-13-19)16-6-2-1-3-7-16/h4-5,8-13,15-16H,1-3,6-7,14H2,(H,26,27,28) |
| InChIKey | OVUXPMOJAUONRV-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.43 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |