C17H26N2O2S — CID 120716650
4-cyclohexyl-N-[(3S)-piperidin-3-yl]benzenesulfonamide (PubChem CID 120716650) has the molecular formula C17H26N2O2S and a molecular weight of 322.47 g/mol. Its IUPAC name is 4-cyclohexyl-N-[(3S)-piperidin-3-yl]benzenesulfonamide.
| Compound Name | 4-cyclohexyl-N-[(3S)-piperidin-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 120716650 |
| Molecular Formula | C17H26N2O2S |
| Molecular Weight | 322.47 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | 4-cyclohexyl-N-[(3S)-piperidin-3-yl]benzenesulfonamide |
| SMILES | O=S(=O)(N[C@H]1CCCNC1)c1ccc(C2CCCCC2)cc1 |
| InChI | InChI=1S/C17H26N2O2S/c20-22(21,19-16-7-4-12-18-13-16)17-10-8-15(9-11-17)14-5-2-1-3-6-14/h8-11,14,16,18-19H,1-7,12-13H2/t16-/m0/s1 |
| InChIKey | SRZCHICXDRNPSL-INIZCTEOSA-N |
| XLogP | 2.76 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.47 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |