C18H24N4O2S — CID 75494864
4-cyclohexyl-N-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)benzenesulfonamide (PubChem CID 75494864) has the molecular formula C18H24N4O2S and a molecular weight of 360.48 g/mol. Its IUPAC name is 4-cyclohexyl-N-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)benzenesulfonamide.
| Compound Name | 4-cyclohexyl-N-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 75494864 |
| Molecular Formula | C18H24N4O2S |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | 4-cyclohexyl-N-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)benzenesulfonamide |
| SMILES | O=S(=O)(NC1CCCn2ncnc21)c1ccc(C2CCCCC2)cc1 |
| InChI | InChI=1S/C18H24N4O2S/c23-25(24,21-17-7-4-12-22-18(17)19-13-20-22)16-10-8-15(9-11-16)14-5-2-1-3-6-14/h8-11,13-14,17,21H,1-7,12H2 |
| InChIKey | IGNIEYYZOKEBJQ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |