C15H20N4O4S2 — CID 129471097
2,5-dimethyl-3-methylsulfonyl-N-[(8S)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl]benzenesulfonamide (PubChem CID 129471097) has the molecular formula C15H20N4O4S2 and a molecular weight of 384.48 g/mol. Its IUPAC name is 2,5-dimethyl-3-methylsulfonyl-N-[(8S)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl]benzenesulfonamide.
| Compound Name | 2,5-dimethyl-3-methylsulfonyl-N-[(8S)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 129471097 |
| Molecular Formula | C15H20N4O4S2 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | 2,5-dimethyl-3-methylsulfonyl-N-[(8S)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl]benzenesulfonamide |
| SMILES | Cc1cc(S(C)(=O)=O)c(C)c(S(=O)(=O)N[C@H]2CCCn3ncnc32)c1 |
| InChI | InChI=1S/C15H20N4O4S2/c1-10-7-13(24(3,20)21)11(2)14(8-10)25(22,23)18-12-5-4-6-19-15(12)16-9-17-19/h7-9,12,18H,4-6H2,1-3H3/t12-/m0/s1 |
| InChIKey | WSXIETICSQSYON-LBPRGKRZSA-N |
| XLogP | 1.11 |
| TPSA | 111.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |