C20H22N4O2S — CID 25499358
4-cyclohexyl-N-[4-(1,2,4-triazol-1-yl)phenyl]benzenesulfonamide (PubChem CID 25499358) has the molecular formula C20H22N4O2S and a molecular weight of 382.49 g/mol. Its IUPAC name is 4-cyclohexyl-N-[4-(1,2,4-triazol-1-yl)phenyl]benzenesulfonamide.
| Compound Name | 4-cyclohexyl-N-[4-(1,2,4-triazol-1-yl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 25499358 |
| Molecular Formula | C20H22N4O2S |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | 4-cyclohexyl-N-[4-(1,2,4-triazol-1-yl)phenyl]benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc(-n2cncn2)cc1)c1ccc(C2CCCCC2)cc1 |
| InChI | InChI=1S/C20H22N4O2S/c25-27(26,20-12-6-17(7-13-20)16-4-2-1-3-5-16)23-18-8-10-19(11-9-18)24-15-21-14-22-24/h6-16,23H,1-5H2 |
| InChIKey | SLKJNVGNXRLPJQ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |