C14H18N4 — CID 54862655
N-cyclohexyl-4-(1,2,4-triazol-1-yl)aniline (PubChem CID 54862655) has the molecular formula C14H18N4 and a molecular weight of 242.33 g/mol. Its IUPAC name is N-cyclohexyl-4-(1,2,4-triazol-1-yl)aniline.
| Compound Name | N-cyclohexyl-4-(1,2,4-triazol-1-yl)aniline |
|---|---|
| PubChem CID | 54862655 |
| Molecular Formula | C14H18N4 |
| Molecular Weight | 242.33 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | N-cyclohexyl-4-(1,2,4-triazol-1-yl)aniline |
| SMILES | c1ncn(-c2ccc(NC3CCCCC3)cc2)n1 |
| InChI | InChI=1S/C14H18N4/c1-2-4-12(5-3-1)17-13-6-8-14(9-7-13)18-11-15-10-16-18/h6-12,17H,1-5H2 |
| InChIKey | AMVIBUGQTDGHIA-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.33 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |