C13H17N5 — CID 54906609
N-[4-(1,2,4-triazol-1-yl)phenyl]piperidin-4-amine (PubChem CID 54906609) has the molecular formula C13H17N5 and a molecular weight of 243.31 g/mol. Its IUPAC name is N-[4-(1,2,4-triazol-1-yl)phenyl]piperidin-4-amine.
| Compound Name | N-[4-(1,2,4-triazol-1-yl)phenyl]piperidin-4-amine |
|---|---|
| PubChem CID | 54906609 |
| Molecular Formula | C13H17N5 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.15 |
| IUPAC Name | N-[4-(1,2,4-triazol-1-yl)phenyl]piperidin-4-amine |
| SMILES | c1ncn(-c2ccc(NC3CCNCC3)cc2)n1 |
| InChI | InChI=1S/C13H17N5/c1-3-13(18-10-15-9-16-18)4-2-11(1)17-12-5-7-14-8-6-12/h1-4,9-10,12,14,17H,5-8H2 |
| InChIKey | DQHOQFLGEJFSRF-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 54.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |