C17H24N4 — CID 65083101
4-ethyl-N-[4-(1,2,4-triazol-1-yl)phenyl]cycloheptan-1-amine (PubChem CID 65083101) has the molecular formula C17H24N4 and a molecular weight of 284.41 g/mol. Its IUPAC name is 4-ethyl-N-[4-(1,2,4-triazol-1-yl)phenyl]cycloheptan-1-amine.
| Compound Name | 4-ethyl-N-[4-(1,2,4-triazol-1-yl)phenyl]cycloheptan-1-amine |
|---|---|
| PubChem CID | 65083101 |
| Molecular Formula | C17H24N4 |
| Molecular Weight | 284.41 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | 4-ethyl-N-[4-(1,2,4-triazol-1-yl)phenyl]cycloheptan-1-amine |
| SMILES | CCC1CCCC(Nc2ccc(-n3cncn3)cc2)CC1 |
| InChI | InChI=1S/C17H24N4/c1-2-14-4-3-5-15(7-6-14)20-16-8-10-17(11-9-16)21-13-18-12-19-21/h8-15,20H,2-7H2,1H3 |
| InChIKey | TWXSMYCCNDUUTO-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.41 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |