C12H16N6 — CID 155941768
N-cyclohexyl-6-(1,2,4-triazol-1-yl)pyrimidin-4-amine (PubChem CID 155941768) has the molecular formula C12H16N6 and a molecular weight of 244.30 g/mol. Its IUPAC name is N-cyclohexyl-6-(1,2,4-triazol-1-yl)pyrimidin-4-amine.
| Compound Name | N-cyclohexyl-6-(1,2,4-triazol-1-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 155941768 |
| Molecular Formula | C12H16N6 |
| Molecular Weight | 244.30 g/mol |
| Exact Mass | 244.14 |
| IUPAC Name | N-cyclohexyl-6-(1,2,4-triazol-1-yl)pyrimidin-4-amine |
| SMILES | c1nc(NC2CCCCC2)cc(-n2cncn2)n1 |
| InChI | InChI=1S/C12H16N6/c1-2-4-10(5-3-1)17-11-6-12(15-8-14-11)18-9-13-7-16-18/h6-10H,1-5H2,(H,14,15,17) |
| InChIKey | TYNOMEFTZSLQLQ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.30 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |