C9H10N6 — CID 155941701
N-cyclopropyl-6-(1,2,4-triazol-1-yl)pyrimidin-4-amine (PubChem CID 155941701) has the molecular formula C9H10N6 and a molecular weight of 202.22 g/mol. Its IUPAC name is N-cyclopropyl-6-(1,2,4-triazol-1-yl)pyrimidin-4-amine.
| Compound Name | N-cyclopropyl-6-(1,2,4-triazol-1-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 155941701 |
| Molecular Formula | C9H10N6 |
| Molecular Weight | 202.22 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | N-cyclopropyl-6-(1,2,4-triazol-1-yl)pyrimidin-4-amine |
| SMILES | c1nc(NC2CC2)cc(-n2cncn2)n1 |
| InChI | InChI=1S/C9H10N6/c1-2-7(1)14-8-3-9(12-5-11-8)15-6-10-4-13-15/h3-7H,1-2H2,(H,11,12,14) |
| InChIKey | JPSUZWCRGOCNQG-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.22 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |