C12H13N5O2 — CID 123757404
4-[6-(1,2,4-triazol-1-yl)pyrimidin-4-yl]oxycyclohexan-1-one (PubChem CID 123757404) has the molecular formula C12H13N5O2 and a molecular weight of 259.27 g/mol. Its IUPAC name is 4-[6-(1,2,4-triazol-1-yl)pyrimidin-4-yl]oxycyclohexan-1-one.
| Compound Name | 4-[6-(1,2,4-triazol-1-yl)pyrimidin-4-yl]oxycyclohexan-1-one |
|---|---|
| PubChem CID | 123757404 |
| Molecular Formula | C12H13N5O2 |
| Molecular Weight | 259.27 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | 4-[6-(1,2,4-triazol-1-yl)pyrimidin-4-yl]oxycyclohexan-1-one |
| SMILES | O=C1CCC(Oc2cc(-n3cncn3)ncn2)CC1 |
| InChI | InChI=1S/C12H13N5O2/c18-9-1-3-10(4-2-9)19-12-5-11(14-7-15-12)17-8-13-6-16-17/h5-8,10H,1-4H2 |
| InChIKey | HFWXZGDNUVFIHK-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 82.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.27 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |