C7H5N5S — CID 19023654
6-(1,2,4-triazol-1-yl)pyrimidine-4-carbothialdehyde (PubChem CID 19023654) has the molecular formula C7H5N5S and a molecular weight of 191.22 g/mol. Its IUPAC name is 6-(1,2,4-triazol-1-yl)pyrimidine-4-carbothialdehyde.
| Compound Name | 6-(1,2,4-triazol-1-yl)pyrimidine-4-carbothialdehyde |
|---|---|
| PubChem CID | 19023654 |
| Molecular Formula | C7H5N5S |
| Molecular Weight | 191.22 g/mol |
| Exact Mass | 191.03 |
| IUPAC Name | 6-(1,2,4-triazol-1-yl)pyrimidine-4-carbothialdehyde |
| SMILES | S=Cc1cc(-n2cncn2)ncn1 |
| InChI | InChI=1S/C7H5N5S/c13-2-6-1-7(10-4-9-6)12-5-8-3-11-12/h1-5H |
| InChIKey | JDBDOZKXVMNKKI-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.22 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|