C8H7ClN4 — CID 61257447
4-(chloromethyl)-2-(1,2,4-triazol-1-yl)pyridine (PubChem CID 61257447) has the molecular formula C8H7ClN4 and a molecular weight of 194.62 g/mol. Its IUPAC name is 4-(chloromethyl)-2-(1,2,4-triazol-1-yl)pyridine.
| Compound Name | 4-(chloromethyl)-2-(1,2,4-triazol-1-yl)pyridine |
|---|---|
| PubChem CID | 61257447 |
| Molecular Formula | C8H7ClN4 |
| Molecular Weight | 194.62 g/mol |
| Exact Mass | 194.04 |
| IUPAC Name | 4-(chloromethyl)-2-(1,2,4-triazol-1-yl)pyridine |
| SMILES | ClCc1ccnc(-n2cncn2)c1 |
| InChI | InChI=1S/C8H7ClN4/c9-4-7-1-2-11-8(3-7)13-6-10-5-12-13/h1-3,5-6H,4H2 |
| InChIKey | UNMYSTLFFDQSTP-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.62 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|