C8H6Cl2N4 — CID 114921142
5-chloro-4-(chloromethyl)-2-(1,2,4-triazol-1-yl)pyridine (PubChem CID 114921142) has the molecular formula C8H6Cl2N4 and a molecular weight of 229.07 g/mol. Its IUPAC name is 5-chloro-4-(chloromethyl)-2-(1,2,4-triazol-1-yl)pyridine.
| Compound Name | 5-chloro-4-(chloromethyl)-2-(1,2,4-triazol-1-yl)pyridine |
|---|---|
| PubChem CID | 114921142 |
| Molecular Formula | C8H6Cl2N4 |
| Molecular Weight | 229.07 g/mol |
| Exact Mass | 228.00 |
| IUPAC Name | 5-chloro-4-(chloromethyl)-2-(1,2,4-triazol-1-yl)pyridine |
| SMILES | ClCc1cc(-n2cncn2)ncc1Cl |
| InChI | InChI=1S/C8H6Cl2N4/c9-2-6-1-8(12-3-7(6)10)14-5-11-4-13-14/h1,3-5H,2H2 |
| InChIKey | QXRKZPKJKRBJSM-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.07 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|