C10H12Cl2N2O2S — CID 114920871
4-[5-chloro-4-(chloromethyl)-2-pyridinyl]-1,4-thiazinane 1,1-dioxide (PubChem CID 114920871) has the molecular formula C10H12Cl2N2O2S and a molecular weight of 295.19 g/mol. Its IUPAC name is 4-[5-chloro-4-(chloromethyl)-2-pyridinyl]-1,4-thiazinane 1,1-dioxide.
| Compound Name | 4-[5-chloro-4-(chloromethyl)-2-pyridinyl]-1,4-thiazinane 1,1-dioxide |
|---|---|
| PubChem CID | 114920871 |
| Molecular Formula | C10H12Cl2N2O2S |
| Molecular Weight | 295.19 g/mol |
| Exact Mass | 294.00 |
| IUPAC Name | 4-[5-chloro-4-(chloromethyl)-2-pyridinyl]-1,4-thiazinane 1,1-dioxide |
| SMILES | O=S1(=O)CCN(c2cc(CCl)c(Cl)cn2)CC1 |
| InChI | InChI=1S/C10H12Cl2N2O2S/c11-6-8-5-10(13-7-9(8)12)14-1-3-17(15,16)4-2-14/h5,7H,1-4,6H2 |
| InChIKey | SHPRGTZVPNDFJW-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.19 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|