C16H16Cl2N2 — CID 114921014
5-chloro-4-(chloromethyl)-2-(3-phenylpyrrolidin-1-yl)pyridine (PubChem CID 114921014) has the molecular formula C16H16Cl2N2 and a molecular weight of 307.22 g/mol. Its IUPAC name is 5-chloro-4-(chloromethyl)-2-(3-phenylpyrrolidin-1-yl)pyridine.
| Compound Name | 5-chloro-4-(chloromethyl)-2-(3-phenylpyrrolidin-1-yl)pyridine |
|---|---|
| PubChem CID | 114921014 |
| Molecular Formula | C16H16Cl2N2 |
| Molecular Weight | 307.22 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | 5-chloro-4-(chloromethyl)-2-(3-phenylpyrrolidin-1-yl)pyridine |
| SMILES | ClCc1cc(N2CCC(c3ccccc3)C2)ncc1Cl |
| InChI | InChI=1S/C16H16Cl2N2/c17-9-14-8-16(19-10-15(14)18)20-7-6-13(11-20)12-4-2-1-3-5-12/h1-5,8,10,13H,6-7,9,11H2 |
| InChIKey | OFKJRFAVDYPMGS-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.22 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|