C11H11Cl2N3 — CID 114921158
5-chloro-4-(chloromethyl)-2-(4,5-dimethylimidazol-1-yl)pyridine (PubChem CID 114921158) has the molecular formula C11H11Cl2N3 and a molecular weight of 256.14 g/mol. Its IUPAC name is 5-chloro-4-(chloromethyl)-2-(4,5-dimethylimidazol-1-yl)pyridine.
| Compound Name | 5-chloro-4-(chloromethyl)-2-(4,5-dimethylimidazol-1-yl)pyridine |
|---|---|
| PubChem CID | 114921158 |
| Molecular Formula | C11H11Cl2N3 |
| Molecular Weight | 256.14 g/mol |
| Exact Mass | 255.03 |
| IUPAC Name | 5-chloro-4-(chloromethyl)-2-(4,5-dimethylimidazol-1-yl)pyridine |
| SMILES | Cc1ncn(-c2cc(CCl)c(Cl)cn2)c1C |
| InChI | InChI=1S/C11H11Cl2N3/c1-7-8(2)16(6-15-7)11-3-9(4-12)10(13)5-14-11/h3,5-6H,4H2,1-2H3 |
| InChIKey | UQMSLPQDNJRXDS-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.14 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|