C9H9FN4 — CID 115417263
4-(4,5-dimethylimidazol-1-yl)-6-fluoropyrimidine (PubChem CID 115417263) has the molecular formula C9H9FN4 and a molecular weight of 192.20 g/mol. Its IUPAC name is 4-(4,5-dimethylimidazol-1-yl)-6-fluoropyrimidine.
| Compound Name | 4-(4,5-dimethylimidazol-1-yl)-6-fluoropyrimidine |
|---|---|
| PubChem CID | 115417263 |
| Molecular Formula | C9H9FN4 |
| Molecular Weight | 192.20 g/mol |
| Exact Mass | 192.08 |
| IUPAC Name | 4-(4,5-dimethylimidazol-1-yl)-6-fluoropyrimidine |
| SMILES | Cc1ncn(-c2cc(F)ncn2)c1C |
| InChI | InChI=1S/C9H9FN4/c1-6-7(2)14(5-13-6)9-3-8(10)11-4-12-9/h3-5H,1-2H3 |
| InChIKey | RYZVYEULOGIGHY-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.20 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |