C12H12BrClN2 — CID 107086042
1-[2-(bromomethyl)-5-chlorophenyl]-4,5-dimethylimidazole (PubChem CID 107086042) has the molecular formula C12H12BrClN2 and a molecular weight of 299.60 g/mol. Its IUPAC name is 1-[2-(bromomethyl)-5-chlorophenyl]-4,5-dimethylimidazole.
| Compound Name | 1-[2-(bromomethyl)-5-chlorophenyl]-4,5-dimethylimidazole |
|---|---|
| PubChem CID | 107086042 |
| Molecular Formula | C12H12BrClN2 |
| Molecular Weight | 299.60 g/mol |
| Exact Mass | 297.99 |
| IUPAC Name | 1-[2-(bromomethyl)-5-chlorophenyl]-4,5-dimethylimidazole |
| SMILES | Cc1ncn(-c2cc(Cl)ccc2CBr)c1C |
| InChI | InChI=1S/C12H12BrClN2/c1-8-9(2)16(7-15-8)12-5-11(14)4-3-10(12)6-13/h3-5,7H,6H2,1-2H3 |
| InChIKey | YKMJTNBKWYSMSW-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.60 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|