C11H11ClN2 — CID 125478648
1-(3-chlorophenyl)-4,5-dimethylimidazole (PubChem CID 125478648) has the molecular formula C11H11ClN2 and a molecular weight of 206.68 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-4,5-dimethylimidazole.
| Compound Name | 1-(3-chlorophenyl)-4,5-dimethylimidazole |
|---|---|
| PubChem CID | 125478648 |
| Molecular Formula | C11H11ClN2 |
| Molecular Weight | 206.68 g/mol |
| Exact Mass | 206.06 |
| IUPAC Name | 1-(3-chlorophenyl)-4,5-dimethylimidazole |
| SMILES | Cc1ncn(-c2cccc(Cl)c2)c1C |
| InChI | InChI=1S/C11H11ClN2/c1-8-9(2)14(7-13-8)11-5-3-4-10(12)6-11/h3-7H,1-2H3 |
| InChIKey | VQQIYHGIIKMQKJ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.68 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |