C12H13ClN2 — CID 115624826
1-[(3-chlorophenyl)methyl]-4,5-dimethylimidazole (PubChem CID 115624826) has the molecular formula C12H13ClN2 and a molecular weight of 220.70 g/mol. Its IUPAC name is 1-[(3-chlorophenyl)methyl]-4,5-dimethylimidazole.
| Compound Name | 1-[(3-chlorophenyl)methyl]-4,5-dimethylimidazole |
|---|---|
| PubChem CID | 115624826 |
| Molecular Formula | C12H13ClN2 |
| Molecular Weight | 220.70 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | 1-[(3-chlorophenyl)methyl]-4,5-dimethylimidazole |
| SMILES | Cc1ncn(Cc2cccc(Cl)c2)c1C |
| InChI | InChI=1S/C12H13ClN2/c1-9-10(2)15(8-14-9)7-11-4-3-5-12(13)6-11/h3-6,8H,7H2,1-2H3 |
| InChIKey | UPMJCOUYKJUUFX-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.70 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |