C12H12BrClN2 — CID 62128432
4-bromo-1-[(3-chlorophenyl)methyl]-3,5-dimethylpyrazole (PubChem CID 62128432) has the molecular formula C12H12BrClN2 and a molecular weight of 299.60 g/mol. Its IUPAC name is 4-bromo-1-[(3-chlorophenyl)methyl]-3,5-dimethylpyrazole.
| Compound Name | 4-bromo-1-[(3-chlorophenyl)methyl]-3,5-dimethylpyrazole |
|---|---|
| PubChem CID | 62128432 |
| Molecular Formula | C12H12BrClN2 |
| Molecular Weight | 299.60 g/mol |
| Exact Mass | 297.99 |
| IUPAC Name | 4-bromo-1-[(3-chlorophenyl)methyl]-3,5-dimethylpyrazole |
| SMILES | Cc1nn(Cc2cccc(Cl)c2)c(C)c1Br |
| InChI | InChI=1S/C12H12BrClN2/c1-8-12(13)9(2)16(15-8)7-10-4-3-5-11(14)6-10/h3-6H,7H2,1-2H3 |
| InChIKey | FDYPYPFHBWMDSM-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.60 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |