C12H14N2O — CID 116621780
4-[(4,5-dimethylimidazol-1-yl)methyl]phenol (PubChem CID 116621780) has the molecular formula C12H14N2O and a molecular weight of 202.26 g/mol. Its IUPAC name is 4-[(4,5-dimethylimidazol-1-yl)methyl]phenol.
| Compound Name | 4-[(4,5-dimethylimidazol-1-yl)methyl]phenol |
|---|---|
| PubChem CID | 116621780 |
| Molecular Formula | C12H14N2O |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | 4-[(4,5-dimethylimidazol-1-yl)methyl]phenol |
| SMILES | Cc1ncn(Cc2ccc(O)cc2)c1C |
| InChI | InChI=1S/C12H14N2O/c1-9-10(2)14(8-13-9)7-11-3-5-12(15)6-4-11/h3-6,8,15H,7H2,1-2H3 |
| InChIKey | INCILKSXHXUPEV-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |